Does anyone have any idea on how to solve this,or have some kind of formula to help me???

Answers

Answer 1
yes so it would be for the first one sin0=0 then you would do sin^-1(0), sin^-1(15) same for cos it would be cos^-1(Angle your looking for here)

Related Questions

Can someone please help me out ~ASAP~.
Suppose a triangle has two sides of length 2 and 3 and that the angle between these two sides is 60degrees. What is the length of the third side of the triangle?

Answers

Answer:

A) 2

Step-by-step explanation:

The law of sines is based on the proportionality of sides and angles in triangles. The law states that for the angles of a non-right triangle, each angle of the triangle has the same ratio of angle measure to sine value.

sin(A)/a=sin(B)/b=sin(C)/c

Substitute the known values into the law of sines to find a.

sin(60)/a=sin(60)/2


can someone pls pls help me ?

Answers

This is wat I solved hope it’s correct

A six foot fence falls over to where its highest point is now only 5 feet high off the ground., how many radians did the fence tilt?

Answers

Answer:

0.5857 radian

Step-by-step explanation:

Given :

Length of fence = 6 feets

Height of fence from ground after tilt = 5 feets

The tilt angle is represented by θ ;

To obtain the angle ; we use the trigonometric relation :

Cosθ = adjacent / hypotenus

Cos θ = 5 / 6

θ = Cos^-1(5/6)

θ = 33.557°

Converting to radian :

33.557 * π/180

= 33.557 * 0.0174532

= 0.58568

= 0.5857 radian

pls help me asap :(

Which of the following values "completes the square," or creates a perfect square trinomial, for x2 − 12x + ___?

Answers

x^2-12x+(6)^2 is correct answer

PLEASE HELPPPP!!!!!!!!

Answers

42x42x62= 109,368
Hope this helps!
1/3(B)h
1/3*(1/2*42*42)*62
18,228 ft^3

which expression has the greatest value?

Answers

Answer:

2nd one

Step-by-step explanation:

Hope this helps,

Applepi101

CO
What is the first step in solving the inequality m2 <-1?
Multiply both sides by 6.
O Add 2 to both sides.
O Change the direction of the inequality.
O Change the inequality to s.

Answers

Answer:

A( multiply both sides by 6)

As seen , the L.C.M is 6 so to do away with the fractional form, we will multiply by 6

5 number summary? Please help this is confusing and please do step by step

Answers

the min is the smallest number in the data set —2
the q1 is the median of the lower half —3
the median is the middle number—5
the q3 is the median of the upper half—8
the max is the highest value in the data set—10

a^2 + b^2 ( giải dùm mình nha )

Answers

Your answer is a2b2 get it

You want to buy a carpet for a room that is 15 feet wide and 18 feet long. Find the amount of carpet that you need.

Answers

270
explanation:
area = length x width
18 x 15 = 270

Determine the value for x in the diagram below when a || b.
55°
х
b
25°
55°
оооо
90°
125°

Answers

Answer:

Step-by-step explanation:

the value of x is 55 degree because the relationship between 55 degree and is that they are corresponding angles and corresponding angles are equal.

Answer:

55°

Have a great day!!! :)

If one person is chosen at random, what would be the probability for it to be someone plays an instrument?​

Answers

Answer:

p = 0.55

Step-by-step explanation:

By looking at the "total" part, we can see that:

There are 20 people surveyed in this case.

We can see that 11 of these play an instrument.

The probability that a person selected at random plays an instrument can be estimated as the relative frequency of people that play an instrument in this survey.

Then the relative frequency of people that play instruments, is equal to the quotient between the number of people that play an instrument and the total number of people surveyed, this is:

p = 11/20 = 0.55

So, we can assume that the probability wanted is 0.55

Write an inequality to represent the graph

Answers

Answer:

B

Using gradient of two points and equation of a straight line graph.

Find the percent of change from 48 people to 71 people. Round to the nearest tenth of a percent if necessary.

Answers

Step-by-step explanation:

Here, the number of people has beed increased.

→ Number of people increased = 71 - 48

→ Number of people increased = 23

[tex] \to \% \: change = \left ( \dfrac{23}{71} \times 100 \right ) \: \% \\ [/tex]

[tex] \to \% \: change = \left ( \dfrac{2300}{71} \right ) \: \% \\ [/tex]

[tex] \red{ \to \% \: change = 32.39 \: \%} \\ [/tex]

Therefore, percentage change is 32.39 %.

¡!URGENT!¡

Find the surface area of the space figure represented by the net

1. 173.5 cm²
2. 263 cm²
3. 191 cm²
4. 245.5 cm²​

Answers

i think the ans is 2. 263cm^2

new community center. How I Find the prime factorization of the number 24​

Answers

Answer:

2*2*2*3

or

2^3   * 3

Step-by-step explanation:

24 = 4*6

But 4 and 6 aren't prime

24 = 4*6 = (2*2)  * (2*3)

All these numbers are prime

24 = 2*2*2*3  or with exponents  = 2^3   * 3

Explain how to check if two or more ratios are a proportion

Answers

Answer:

¿Cómo comprobar que las razones son proporcionales? ,5

Step-by-step explanation:

Para comprobar si dos o más razones son proporcionales se aplica la propiedad fundamental de las proporciones. 1 * 4 = 1 2 2 4 4 = 4 1 2 3 6 1 * 6 = 6 = 6 = = ? ? 1 2 0,5 1 = Así se concluye que las tres razones son proporcionales. 1 * 1 = 1 = 1 1ra forma. 2 * 2 2 * 3 ? 2 * 0,5

Quick!! I need an answer fast! worth 40 POINTS!
Choose all the equations which are correctly solved.
A) x2 − 5x + 5 = 0 {2, 3}
B)x2 − 7x − 8 = 0 {−1, 8}
C) x2 + 12x + 20 = 0 {−2, −10}
D) x2 − 3x − 10 = 0 {2, 10}
E) x2 + x + 20 = 0 {4, 5}

Answers

Answer:

B) & C)

Step-by-step explanation:

___________________

can you guys help me plz

Answers

Answer:

Step-by-step explanation:

x = 10sqrt(2)*cos(60) = 5sqrt(2) = 7.07 approx.

y = 10sqrt(2)*sin(60) = 10sqrt(2)*sqrt(3)/2 = 5sqrt(6)=12.25 approx.


True or False:
(1, 2) is a solution to the following system of equations:
5x +y=7
7x – 2y = 3
A) True
B) False

Answers

Step-by-step explanation:

LHS = 5x+y =5(1)+2= 5+2= 7

RHS = 7

since LHS= RHS

LHS = 7x-2y =7(1)-2(2)=7-4=3

RHS = 3

since LHS=RHS

(1, 2) is a solution to the following system of equations.

True

Hi there!  

»»————- ★ ————-««

I believe your answer is:  

A) True

»»————- ★ ————-««  

Here’s why:  

I have used a graphing program to graph the lines given. When they are graphed, the lines intercept at the point (1,2). This means that it is a solution to the system, and the given statement is true. See the graph attached.

»»————- ★ ————-««  

Hope this helps you. I apologize if it’s incorrect.  

is 7,24,26 an acute triangle

Answers

Answer:

Maybe

Step-by-step explanation:

If its in degrees then for sure.

But if its labeled those values then I'm not 100% sure.

A car is traveling at a constant rate of x miles per hour how many miles will the car travel in y minutes

Answers

Answer:

Step-by-step explanation:

1 mile

helppppppp pleaseeee f/4 - 5 = -9

Answers

Answer:

Step-by-step explanation:

f/4-5=-9

f-4*5/4=-9

f-20/4=-9

f-20=-9*4

f-20=-36

f=-36+20

f=-16

Answer:

f/4 - 5 = -9

f-20/4=-9

f-20=-9×4

f-20=-36

f=-36+20

f=-16

its a very simple question... wanna get brainliest. if so answer this ..
Did I colored the parts correct ... should the denominator be 4 instead of 2..??? ​

Answers

If you want it to be 1/2 then you would have to color in another part, but if you want it to be 1/4 then that’s what you drew and you would have to change the denominator to a 4.

I hope this helped.

Help please will be marked as brainliest if correct

Answers

Answer:

12.95

Step-by-step explanation:

1. 173.43

2. 325.54

3. 0.6794

4. 76.45

Unlock number: 12.95

Answer:

173.43

325.54

.6794

76.45

Step-by-step explanation:

PLEASE HELP ME
What is the value of x?
2x +10 & 4x + 20

Answers:

A. 20
B. 25
C. 180
D. 120

Answers

Answer:

Step-by-step explanation:

x can really be anything because you did not include the sum for both expressions. so im not sure. its best to wait for someone else to answer. :/

Mr. Takaya can eat four slices of pizza in seven minutes. If he continues to eat at the
same rate, how long will it take him to eat the whole pizza, which has twelve slices?

How many slices could he eat in 35 minutes?

Answers

If he continues to eat at the same rate for 35 minutes, he'll have diabetes.

The population of a school is 800 students and is increasing at a rate of 2% per year. Write
an exponential growth function, then find the population of the school after 9 years.
Why is it not giving the right answer

Answers

Answer:

After 9 years the population would be 956. The exponential growth function would be [tex]x(956)=800_{0} (1+\frac{2}{100})^{9}[/tex]

Step-by-step explanation:

y=a(1+r)x

a = initial amount

r = growth rate as a decimal

x = number of time intervals passed (days, months, years)

y = amount after x time

This formula is used to express a function of exponential growth.

Can someone help me solve question 2 and 3?

Answers

Answer:

Question 2 = 15 drinks

Question 3 = 7/12

Step-by-step explanation:

Question 2:

For every drink, there are three sizes

Ratio = 1:3

There are 5 flavors

Multiply each side by 5

5:15

15 drinks

Question 3:

5 red, 6 yellow, 8 blue, 3 orange, 2 purple

Possible outcomes = 5 + 6 + 8 + 3 + 2 = 24 possible outcomes

Favourable outcomes = 6 + 8 = 14 favourable outcomes

Fraction = 14/24 = 7/12

If my answer is incorrect, pls correct me!

If you like my answer and explanation, mark me as brainliest!

-Chetan K

Evaluate.
(-5)3 =
this is needed fast pls

Answers

Answer:

The answer is -15

Step-by-step explanation:

(-5)3 is the same as -5 × 3

Answer:

The answer is -15

-5 x 3 = -15

Other Questions
In the selection fromFrankenstein, how does Victor feel as he returns to Geneva?Help https://brainly .com/app/profile/2790115/answers To what extent do covalent compounds conduct electricity?alwaysusuallyrarelynever Please help me find the length of su A right triangle has side lengths 5, 12, and 13 as shown below. Use these lengths to find tan B, sinB, and cos B. (marking brainlist) What is the name of Washington's final public statement of political philosophy? speech about an open secret What does your life mean? Describe its purpose ? Write the statement that represents 3 times the sum of 2 and 4"? if I simplify the formula -3 (-10)+5(-10)= There are 4.5 litres of milk in a pot. The chef stirs in 2.5 g of salt and 1.2 litres of water. How much liquid is in the pot? Need answer ASAP!!! Ill mark brainliest if correct Select the correct answer.What is the effect of the structure in the essay "Loneliness. an American Malady" by Carson McCullers?A.The clear and concise narration allows the reader to draw connections across the essay.B.The stream-of-consciousness narration allows a more intimate connection to the reader. aC.The melancholic thoughts in the narration create a frustrated and incoherent mood.D.The sense of moral isolation creates a need to belong among emotionally detached readers. Gross billings for merchandise sold by Cullumber Company to its customers last year amounted to $12720000; sales returns and allowances were $360000, sales discounts were $175300, and freight-out was $139400. Net sales last year for Cullumber Company were:____.a. $12,720,000.b. $12,275,000.c. $12,175,000.d. None of the above. Which face of the rectangular prism has the same shape and dimensions as the cross section shown in the figure? Select all that apply. The vast majority of research literature has taught us that reward is much more effective than punishment in caring for our children. This is also true with our beloved doggies, yet out of frustration and lack of control, some owners hit their dogs as a method of training. The most common example is when a dog is being trained to be house broken (only urinating and defecating outdoors). It would stand to reason that moments of accidents (which are not only to be expected but) are opportunities for learning and training. Unfortunately, this is not always the case. I have witnessed owners yelling at and spanking their dog when they have discovered poop in their homes and the dog of course responds by cowering. If this persists (just more than once is all it takes), what happens then is that every time an owner raises their hand quickly (regardless of the reason; swatting a mosquito, gesticulation), the dog flinches with fear. Suppose a consumer with an income of $100 is faced with Px = 1 and Py = 1/2. What is the market rate of substitution between good X (horizontal axis) and good Y (vertical axis)? A. 0.50 B. -1.0 C. -2.0 D. -4.0 State the next three terms of Fibonacci sequence 1,1,2,3,5,8,13 I was so late this morning . By the time I ...........(get) to work, I.........(miss) the whole meeting Since the age of fifteen, which was eleven years before, Robert each summer at Grand Isle had constituted himself the devoted attendant of some fair dame or damsel. Sometimes it was a young girl, again a widow, but as often as not it was some interesting married woman. A story timeline showing exposition at the base of the timeline. The rising actions shows an increasing line. The climax is the highest point of the timeline. The falling action shows a decreasing line. The resolution is at the base of the timeline. Which best explains this excerpts purpose in the novels plot structure? 1. Joe used the Pythagorean theorem to make sure the picture frame he made is a preciserectangle.8 feetx feetIf Joe's picture frame is a precise rectangle, and the diagonal in the rectangle above is 10feet, what is the width of the frame, x?